C12H21F3N2O3 — CID 67032394
N-butylpiperidin-1-ium-4-carboxamide;2,2,2-trifluoroacetate (PubChem CID 67032394) has the molecular formula C12H21F3N2O3 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-butylpiperidin-1-ium-4-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | N-butylpiperidin-1-ium-4-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67032394 |
| Molecular Formula | C12H21F3N2O3 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-butylpiperidin-1-ium-4-carboxamide;2,2,2-trifluoroacetate |
| SMILES | CCCCNC(=O)C1CC[NH2+]CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C10H20N2O.C2HF3O2/c1-2-3-6-12-10(13)9-4-7-11-8-5-9;3-2(4,5)1(6)7/h9,11H,2-8H2,1H3,(H,12,13);(H,6,7) |
| InChIKey | WGGLXXIZFXXYJM-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|