C12H12F2INO3 — CID 67033346
(E)-N-[3-(difluoromethoxy)-4-iodophenyl]-3-ethoxyprop-2-enamide (PubChem CID 67033346) has the molecular formula C12H12F2INO3 and a molecular weight of 383.13 g/mol. Its IUPAC name is (E)-N-[3-(difluoromethoxy)-4-iodophenyl]-3-ethoxyprop-2-enamide.
| Compound Name | (E)-N-[3-(difluoromethoxy)-4-iodophenyl]-3-ethoxyprop-2-enamide |
|---|---|
| PubChem CID | 67033346 |
| Molecular Formula | C12H12F2INO3 |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | (E)-N-[3-(difluoromethoxy)-4-iodophenyl]-3-ethoxyprop-2-enamide |
| SMILES | CCO/C=C/C(=O)Nc1ccc(I)c(OC(F)F)c1 |
| InChI | InChI=1S/C12H12F2INO3/c1-2-18-6-5-11(17)16-8-3-4-9(15)10(7-8)19-12(13)14/h3-7,12H,2H2,1H3,(H,16,17)/b6-5+ |
| InChIKey | DQQYEZBONFJTDW-AATRIKPKSA-N |
| XLogP | 3.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|