C16H14F3IN2O3S — CID 67034634
N-[2-iodo-4-(trifluoromethyl)phenyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide (PubChem CID 67034634) has the molecular formula C16H14F3IN2O3S and a molecular weight of 498.26 g/mol. Its IUPAC name is N-[2-iodo-4-(trifluoromethyl)phenyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-[2-iodo-4-(trifluoromethyl)phenyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 67034634 |
| Molecular Formula | C16H14F3IN2O3S |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | N-[2-iodo-4-(trifluoromethyl)phenyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide |
| SMILES | CN1CCOc2ccc(S(=O)(=O)Nc3ccc(C(F)(F)F)cc3I)cc21 |
| InChI | InChI=1S/C16H14F3IN2O3S/c1-22-6-7-25-15-5-3-11(9-14(15)22)26(23,24)21-13-4-2-10(8-12(13)20)16(17,18)19/h2-5,8-9,21H,6-7H2,1H3 |
| InChIKey | ZWWVPCGNUXCVJX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|