C11H21NO2S — CID 67034878
tert-butyl 3,3-dimethylthiomorpholine-4-carboxylate (PubChem CID 67034878) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is tert-butyl 3,3-dimethylthiomorpholine-4-carboxylate.
| Compound Name | tert-butyl 3,3-dimethylthiomorpholine-4-carboxylate |
|---|---|
| PubChem CID | 67034878 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl 3,3-dimethylthiomorpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCSCC1(C)C |
| InChI | InChI=1S/C11H21NO2S/c1-10(2,3)14-9(13)12-6-7-15-8-11(12,4)5/h6-8H2,1-5H3 |
| InChIKey | AFPHGROPWXSXKJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |