C11H13IN4O2 — CID 67035257
3-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)-1-(hydroxymethyl)cyclobutan-1-ol (PubChem CID 67035257) has the molecular formula C11H13IN4O2 and a molecular weight of 360.16 g/mol. Its IUPAC name is 3-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)-1-(hydroxymethyl)cyclobutan-1-ol.
| Compound Name | 3-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)-1-(hydroxymethyl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 67035257 |
| Molecular Formula | C11H13IN4O2 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 3-(8-amino-1-iodoimidazo[1,5-a]pyrazin-3-yl)-1-(hydroxymethyl)cyclobutan-1-ol |
| SMILES | Nc1nccn2c(C3CC(O)(CO)C3)nc(I)c12 |
| InChI | InChI=1S/C11H13IN4O2/c12-8-7-9(13)14-1-2-16(7)10(15-8)6-3-11(18,4-6)5-17/h1-2,6,17-18H,3-5H2,(H2,13,14) |
| InChIKey | XYPFOPIMWJEGTM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|