C33H23BrN4O5S — CID 67040741
9H-fluoren-9-ylmethyl N-[4-[4-[(5-bromo-3-pyridinyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate (PubChem CID 67040741) has the molecular formula C33H23BrN4O5S and a molecular weight of 667.54 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[4-[(5-bromo-3-pyridinyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[4-[(5-bromo-3-pyridinyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 67040741 |
| Molecular Formula | C33H23BrN4O5S |
| Molecular Weight | 667.54 g/mol |
| Exact Mass | 666.06 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[4-[(5-bromo-3-pyridinyl)carbamoyl]-2-nitrophenyl]sulfanylphenyl]carbamate |
| SMILES | O=C(Nc1ccc(Sc2ccc(C(=O)Nc3cncc(Br)c3)cc2[N+](=O)[O-])cc1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C33H23BrN4O5S/c34-21-16-23(18-35-17-21)36-32(39)20-9-14-31(30(15-20)38(41)42)44-24-12-10-22(11-13-24)37-33(40)43-19-29-27-7-3-1-5-25(27)26-6-2-4-8-28(26)29/h1-18,29H,19H2,(H,36,39)(H,37,40) |
| InChIKey | KYYYMNWUYQOFDS-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.54 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|