C33H25FN4O3S — CID 67041003
9H-fluoren-9-ylmethyl N-[4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamate (PubChem CID 67041003) has the molecular formula C33H25FN4O3S and a molecular weight of 576.65 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 67041003 |
| Molecular Formula | C33H25FN4O3S |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamate |
| SMILES | Nc1cc(C(=O)Nc2cncc(F)c2)ccc1Sc1ccc(NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C33H25FN4O3S/c34-21-16-23(18-36-17-21)37-32(39)20-9-14-31(30(35)15-20)42-24-12-10-22(11-13-24)38-33(40)41-19-29-27-7-3-1-5-25(27)26-6-2-4-8-28(26)29/h1-18,29H,19,35H2,(H,37,39)(H,38,40) |
| InChIKey | BALWIINRSKKPKI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|