C19H15FN4O3S — CID 91053108
[4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid (PubChem CID 91053108) has the molecular formula C19H15FN4O3S and a molecular weight of 398.42 g/mol. Its IUPAC name is [4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid.
| Compound Name | [4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid |
|---|---|
| PubChem CID | 91053108 |
| Molecular Formula | C19H15FN4O3S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [4-[2-amino-4-[(5-fluoro-3-pyridinyl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid |
| SMILES | Nc1cc(C(=O)Nc2cncc(F)c2)ccc1Sc1ccc(NC(=O)O)cc1 |
| InChI | InChI=1S/C19H15FN4O3S/c20-12-8-14(10-22-9-12)23-18(25)11-1-6-17(16(21)7-11)28-15-4-2-13(3-5-15)24-19(26)27/h1-10,24H,21H2,(H,23,25)(H,26,27) |
| InChIKey | JMPOSOJGIXJPGN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|