C17H13BrN4O3S2 — CID 141181398
[4-[2-amino-4-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid (PubChem CID 141181398) has the molecular formula C17H13BrN4O3S2 and a molecular weight of 465.35 g/mol. Its IUPAC name is [4-[2-amino-4-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid.
| Compound Name | [4-[2-amino-4-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid |
|---|---|
| PubChem CID | 141181398 |
| Molecular Formula | C17H13BrN4O3S2 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | [4-[2-amino-4-[(5-bromo-1,3-thiazol-2-yl)carbamoyl]phenyl]sulfanylphenyl]carbamic acid |
| SMILES | Nc1cc(C(=O)Nc2ncc(Br)s2)ccc1Sc1ccc(NC(=O)O)cc1 |
| InChI | InChI=1S/C17H13BrN4O3S2/c18-14-8-20-16(27-14)22-15(23)9-1-6-13(12(19)7-9)26-11-4-2-10(3-5-11)21-17(24)25/h1-8,21H,19H2,(H,24,25)(H,20,22,23) |
| InChIKey | RUWSCRWWQSJUHT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|