C23H18F2N2O4 — CID 2759755
methyl 5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-difluorobenzoate (PubChem CID 2759755) has the molecular formula C23H18F2N2O4 and a molecular weight of 424.40 g/mol. Its IUPAC name is methyl 5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-difluorobenzoate.
| Compound Name | methyl 5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 2759755 |
| Molecular Formula | C23H18F2N2O4 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl 5-amino-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2,3-difluorobenzoate |
| SMILES | COC(=O)c1cc(N)c(NC(=O)OCC2c3ccccc3-c3ccccc32)c(F)c1F |
| InChI | InChI=1S/C23H18F2N2O4/c1-30-22(28)16-10-18(26)21(20(25)19(16)24)27-23(29)31-11-17-14-8-4-2-6-12(14)13-7-3-5-9-15(13)17/h2-10,17H,11,26H2,1H3,(H,27,29) |
| InChIKey | XBWNJDPZTJVEPE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|