C16H11ClF3NO4 — CID 67041697
methyl 4-[[3-chloro-4-hydroxy-5-(trifluoromethyl)benzoyl]amino]benzoate (PubChem CID 67041697) has the molecular formula C16H11ClF3NO4 and a molecular weight of 373.71 g/mol. Its IUPAC name is methyl 4-[[3-chloro-4-hydroxy-5-(trifluoromethyl)benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[3-chloro-4-hydroxy-5-(trifluoromethyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 67041697 |
| Molecular Formula | C16H11ClF3NO4 |
| Molecular Weight | 373.71 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | methyl 4-[[3-chloro-4-hydroxy-5-(trifluoromethyl)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(Cl)c(O)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H11ClF3NO4/c1-25-15(24)8-2-4-10(5-3-8)21-14(23)9-6-11(16(18,19)20)13(22)12(17)7-9/h2-7,22H,1H3,(H,21,23) |
| InChIKey | MLXNSUNNLBASTJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |