C9H11ClF2N2O2S — CID 67042982
N-(3-amino-2-chloro-4-fluorophenyl)-3-fluoropropane-1-sulfonamide (PubChem CID 67042982) has the molecular formula C9H11ClF2N2O2S and a molecular weight of 284.72 g/mol. Its IUPAC name is N-(3-amino-2-chloro-4-fluorophenyl)-3-fluoropropane-1-sulfonamide.
| Compound Name | N-(3-amino-2-chloro-4-fluorophenyl)-3-fluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 67042982 |
| Molecular Formula | C9H11ClF2N2O2S |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | N-(3-amino-2-chloro-4-fluorophenyl)-3-fluoropropane-1-sulfonamide |
| SMILES | Nc1c(F)ccc(NS(=O)(=O)CCCF)c1Cl |
| InChI | InChI=1S/C9H11ClF2N2O2S/c10-8-7(3-2-6(12)9(8)13)14-17(15,16)5-1-4-11/h2-3,14H,1,4-5,13H2 |
| InChIKey | VHQCSRXUPSGLTJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|