C17H18Cl2FN3O — CID 67043295
5-chloro-6-(5-chloro-2-fluoro-4-pyridinyl)-N-[2-(oxan-4-yl)ethyl]pyridin-2-amine (PubChem CID 67043295) has the molecular formula C17H18Cl2FN3O and a molecular weight of 370.26 g/mol. Its IUPAC name is 5-chloro-6-(5-chloro-2-fluoro-4-pyridinyl)-N-[2-(oxan-4-yl)ethyl]pyridin-2-amine.
| Compound Name | 5-chloro-6-(5-chloro-2-fluoro-4-pyridinyl)-N-[2-(oxan-4-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 67043295 |
| Molecular Formula | C17H18Cl2FN3O |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 5-chloro-6-(5-chloro-2-fluoro-4-pyridinyl)-N-[2-(oxan-4-yl)ethyl]pyridin-2-amine |
| SMILES | Fc1cc(-c2nc(NCCC3CCOCC3)ccc2Cl)c(Cl)cn1 |
| InChI | InChI=1S/C17H18Cl2FN3O/c18-13-1-2-16(21-6-3-11-4-7-24-8-5-11)23-17(13)12-9-15(20)22-10-14(12)19/h1-2,9-11H,3-8H2,(H,21,23) |
| InChIKey | YXXPUGLRBCIUDR-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|