C16H19FN4O — CID 141285797
6-(2-amino-4-pyridinyl)-5-fluoro-N-(oxan-4-ylmethyl)pyridin-2-amine (PubChem CID 141285797) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is 6-(2-amino-4-pyridinyl)-5-fluoro-N-(oxan-4-ylmethyl)pyridin-2-amine.
| Compound Name | 6-(2-amino-4-pyridinyl)-5-fluoro-N-(oxan-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 141285797 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 6-(2-amino-4-pyridinyl)-5-fluoro-N-(oxan-4-ylmethyl)pyridin-2-amine |
| SMILES | Nc1cc(-c2nc(NCC3CCOCC3)ccc2F)ccn1 |
| InChI | InChI=1S/C16H19FN4O/c17-13-1-2-15(20-10-11-4-7-22-8-5-11)21-16(13)12-3-6-19-14(18)9-12/h1-3,6,9,11H,4-5,7-8,10H2,(H2,18,19)(H,20,21) |
| InChIKey | GVIDKKYRPBACFQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |