C11H15F2N3O — CID 114074477
3,5-difluoro-6-N-(oxan-4-ylmethyl)pyridine-2,6-diamine (PubChem CID 114074477) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 3,5-difluoro-6-N-(oxan-4-ylmethyl)pyridine-2,6-diamine.
| Compound Name | 3,5-difluoro-6-N-(oxan-4-ylmethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 114074477 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3,5-difluoro-6-N-(oxan-4-ylmethyl)pyridine-2,6-diamine |
| SMILES | Nc1nc(NCC2CCOCC2)c(F)cc1F |
| InChI | InChI=1S/C11H15F2N3O/c12-8-5-9(13)11(16-10(8)14)15-6-7-1-3-17-4-2-7/h5,7H,1-4,6H2,(H3,14,15,16) |
| InChIKey | NGPURECYPFTMEP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |