About 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol
2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol (PubChem CID 67047598) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol.
Analyze 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol (CID 67047598) is 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol is CC1=CC(C(C)(C)C)=C(O)C(C)(C(C)(C)C)C1.
What is the InChIKey of 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol?
The InChIKey is RUELPJGJTPURTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O/c1-11-9-12(14(2,3)4)13(17)16(8,10-11)15(5,6)7/h9,17H,10H2,1-8H3.
What are the key properties of 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol?
2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol has a molecular weight of 236.40 g/mol, XLogP of 5.25, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4,6-dimethylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 67047598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).