C20H15N3O5S — CID 67052227
methyl 4-(1-benzofuran-2-carbonylamino)-2-(5-methoxypyrazin-2-yl)thiophene-3-carboxylate (PubChem CID 67052227) has the molecular formula C20H15N3O5S and a molecular weight of 409.42 g/mol. Its IUPAC name is methyl 4-(1-benzofuran-2-carbonylamino)-2-(5-methoxypyrazin-2-yl)thiophene-3-carboxylate.
| Compound Name | methyl 4-(1-benzofuran-2-carbonylamino)-2-(5-methoxypyrazin-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 67052227 |
| Molecular Formula | C20H15N3O5S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | methyl 4-(1-benzofuran-2-carbonylamino)-2-(5-methoxypyrazin-2-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc3ccccc3o2)csc1-c1cnc(OC)cn1 |
| InChI | InChI=1S/C20H15N3O5S/c1-26-16-9-21-12(8-22-16)18-17(20(25)27-2)13(10-29-18)23-19(24)15-7-11-5-3-4-6-14(11)28-15/h3-10H,1-2H3,(H,23,24) |
| InChIKey | OMBDWPJTGCZYJV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |