C21H19Cl2N3O — CID 67053167
1-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(2-methyl-4-pyridinyl)phenyl]urea (PubChem CID 67053167) has the molecular formula C21H19Cl2N3O and a molecular weight of 400.31 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(2-methyl-4-pyridinyl)phenyl]urea.
| Compound Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(2-methyl-4-pyridinyl)phenyl]urea |
|---|---|
| PubChem CID | 67053167 |
| Molecular Formula | C21H19Cl2N3O |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-[4-(2-methyl-4-pyridinyl)phenyl]urea |
| SMILES | Cc1cc(-c2ccc(NC(=O)NCCc3ccc(Cl)cc3Cl)cc2)ccn1 |
| InChI | InChI=1S/C21H19Cl2N3O/c1-14-12-17(9-10-24-14)15-3-6-19(7-4-15)26-21(27)25-11-8-16-2-5-18(22)13-20(16)23/h2-7,9-10,12-13H,8,11H2,1H3,(H2,25,26,27) |
| InChIKey | NCIHSTIFKOOCLN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |