C12H22N5S+ — CID 67053287
5-(1-piperidin-4-ylpiperidin-1-ium-1-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 67053287) has the molecular formula C12H22N5S+ and a molecular weight of 268.41 g/mol. Its IUPAC name is 5-(1-piperidin-4-ylpiperidin-1-ium-1-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(1-piperidin-4-ylpiperidin-1-ium-1-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 67053287 |
| Molecular Formula | C12H22N5S+ |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 5-(1-piperidin-4-ylpiperidin-1-ium-1-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc([N+]2(C3CCNCC3)CCCCC2)s1 |
| InChI | InChI=1S/C12H22N5S/c13-11-15-16-12(18-11)17(8-2-1-3-9-17)10-4-6-14-7-5-10/h10,14H,1-9H2,(H2,13,15)/q+1 |
| InChIKey | VCWHGJBNQBEZRX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|