C14H24N4S — CID 154101878
2-N,5-N-dicyclohexyl-1,3,4-thiadiazole-2,5-diamine (PubChem CID 154101878) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-N,5-N-dicyclohexyl-1,3,4-thiadiazole-2,5-diamine.
| Compound Name | 2-N,5-N-dicyclohexyl-1,3,4-thiadiazole-2,5-diamine |
|---|---|
| PubChem CID | 154101878 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-N,5-N-dicyclohexyl-1,3,4-thiadiazole-2,5-diamine |
| SMILES | C1CCC(Nc2nnc(NC3CCCCC3)s2)CC1 |
| InChI | InChI=1S/C14H24N4S/c1-3-7-11(8-4-1)15-13-17-18-14(19-13)16-12-9-5-2-6-10-12/h11-12H,1-10H2,(H,15,17)(H,16,18) |
| InChIKey | KCDWTWZVWHGSOB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |