C9H16N4S — CID 19016677
2-N-(cyclohexylmethyl)-1,3,4-thiadiazole-2,5-diamine (PubChem CID 19016677) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-N-(cyclohexylmethyl)-1,3,4-thiadiazole-2,5-diamine.
| Compound Name | 2-N-(cyclohexylmethyl)-1,3,4-thiadiazole-2,5-diamine |
|---|---|
| PubChem CID | 19016677 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-N-(cyclohexylmethyl)-1,3,4-thiadiazole-2,5-diamine |
| SMILES | Nc1nnc(NCC2CCCCC2)s1 |
| InChI | InChI=1S/C9H16N4S/c10-8-12-13-9(14-8)11-6-7-4-2-1-3-5-7/h7H,1-6H2,(H2,10,12)(H,11,13) |
| InChIKey | MZJYIZRMTXACSF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |