C9H16N4O2S2 — CID 162653721
5-(cyclohexylmethylamino)-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 162653721) has the molecular formula C9H16N4O2S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 5-(cyclohexylmethylamino)-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-(cyclohexylmethylamino)-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 162653721 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-(cyclohexylmethylamino)-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NCC2CCCCC2)s1 |
| InChI | InChI=1S/C9H16N4O2S2/c10-17(14,15)9-13-12-8(16-9)11-6-7-4-2-1-3-5-7/h7H,1-6H2,(H,11,12)(H2,10,14,15) |
| InChIKey | BMKNJFVKKYCAND-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |