C10H18N4O2S2 — CID 171354578
5-(2-cyclohexylethylamino)-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 171354578) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 5-(2-cyclohexylethylamino)-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-(2-cyclohexylethylamino)-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 171354578 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-(2-cyclohexylethylamino)-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NCCC2CCCCC2)s1 |
| InChI | InChI=1S/C10H18N4O2S2/c11-18(15,16)10-14-13-9(17-10)12-7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H,12,13)(H2,11,15,16) |
| InChIKey | OMWAOWKSUHCXGV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |