C10H19N3S — CID 57140898
N-(2-ethylhexyl)-1,3,4-thiadiazol-2-amine (PubChem CID 57140898) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-ethylhexyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 57140898 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-(2-ethylhexyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCC(CC)CNc1nncs1 |
| InChI | InChI=1S/C10H19N3S/c1-3-5-6-9(4-2)7-11-10-13-12-8-14-10/h8-9H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | XGCDQIRVAOGSEI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |