C20H18ClFN4O3 — CID 67060280
N-[4-(8a-methyl-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)-3-chlorophenyl]-3-fluoropyridine-2-carboxamide (PubChem CID 67060280) has the molecular formula C20H18ClFN4O3 and a molecular weight of 416.84 g/mol. Its IUPAC name is N-[4-(8a-methyl-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)-3-chlorophenyl]-3-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-(8a-methyl-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)-3-chlorophenyl]-3-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 67060280 |
| Molecular Formula | C20H18ClFN4O3 |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[4-(8a-methyl-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-2-yl)-3-chlorophenyl]-3-fluoropyridine-2-carboxamide |
| SMILES | CC12CCCCN1C(=O)N(c1ccc(NC(=O)c3ncccc3F)cc1Cl)C2=O |
| InChI | InChI=1S/C20H18ClFN4O3/c1-20-8-2-3-10-25(20)19(29)26(18(20)28)15-7-6-12(11-13(15)21)24-17(27)16-14(22)5-4-9-23-16/h4-7,9,11H,2-3,8,10H2,1H3,(H,24,27) |
| InChIKey | UBFUSRIPEGWXMU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|