C14H16N4 — CID 67060658
2-[(3S)-3-aminopyrrolidin-1-yl]-1-methylindole-3-carbonitrile (PubChem CID 67060658) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-[(3S)-3-aminopyrrolidin-1-yl]-1-methylindole-3-carbonitrile.
| Compound Name | 2-[(3S)-3-aminopyrrolidin-1-yl]-1-methylindole-3-carbonitrile |
|---|---|
| PubChem CID | 67060658 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[(3S)-3-aminopyrrolidin-1-yl]-1-methylindole-3-carbonitrile |
| SMILES | Cn1c(N2CC[C@H](N)C2)c(C#N)c2ccccc21 |
| InChI | InChI=1S/C14H16N4/c1-17-13-5-3-2-4-11(13)12(8-15)14(17)18-7-6-10(16)9-18/h2-5,10H,6-7,9,16H2,1H3/t10-/m0/s1 |
| InChIKey | QUZPLAFUEKPFMI-JTQLQIEISA-N |
| XLogP | 1.59 |
| TPSA | 57.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |