C9H8ClN3OS — CID 67061325
4-(4-chloro-1-methylpyrazol-5-yl)thiophene-2-carboxamide (PubChem CID 67061325) has the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. Its IUPAC name is 4-(4-chloro-1-methylpyrazol-5-yl)thiophene-2-carboxamide.
| Compound Name | 4-(4-chloro-1-methylpyrazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67061325 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 4-(4-chloro-1-methylpyrazol-5-yl)thiophene-2-carboxamide |
| SMILES | Cn1ncc(Cl)c1-c1csc(C(N)=O)c1 |
| InChI | InChI=1S/C9H8ClN3OS/c1-13-8(6(10)3-12-13)5-2-7(9(11)14)15-4-5/h2-4H,1H3,(H2,11,14) |
| InChIKey | NKOZBQHHOLIOIA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |