C22H26F3N3 — CID 67064883
1-[2-[[2-[4-phenyl-2-(trifluoromethyl)phenyl]cyclopropyl]amino]ethyl]pyrrolidin-3-amine (PubChem CID 67064883) has the molecular formula C22H26F3N3 and a molecular weight of 389.47 g/mol. Its IUPAC name is 1-[2-[[2-[4-phenyl-2-(trifluoromethyl)phenyl]cyclopropyl]amino]ethyl]pyrrolidin-3-amine.
| Compound Name | 1-[2-[[2-[4-phenyl-2-(trifluoromethyl)phenyl]cyclopropyl]amino]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 67064883 |
| Molecular Formula | C22H26F3N3 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[2-[[2-[4-phenyl-2-(trifluoromethyl)phenyl]cyclopropyl]amino]ethyl]pyrrolidin-3-amine |
| SMILES | NC1CCN(CCNC2CC2c2ccc(-c3ccccc3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H26F3N3/c23-22(24,25)20-12-16(15-4-2-1-3-5-15)6-7-18(20)19-13-21(19)27-9-11-28-10-8-17(26)14-28/h1-7,12,17,19,21,27H,8-11,13-14,26H2 |
| InChIKey | GLZJPIMYVOKGDH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |