C24H28N2O6 — CID 67066562
4-[3-tert-butyl-2-methoxy-5-(3-methoxyprop-2-enoylcarbamoylamino)phenyl]-3-methylbenzoic acid (PubChem CID 67066562) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-[3-tert-butyl-2-methoxy-5-(3-methoxyprop-2-enoylcarbamoylamino)phenyl]-3-methylbenzoic acid.
| Compound Name | 4-[3-tert-butyl-2-methoxy-5-(3-methoxyprop-2-enoylcarbamoylamino)phenyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 67066562 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-[3-tert-butyl-2-methoxy-5-(3-methoxyprop-2-enoylcarbamoylamino)phenyl]-3-methylbenzoic acid |
| SMILES | COC=CC(=O)NC(=O)Nc1cc(-c2ccc(C(=O)O)cc2C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H28N2O6/c1-14-11-15(22(28)29)7-8-17(14)18-12-16(13-19(21(18)32-6)24(2,3)4)25-23(30)26-20(27)9-10-31-5/h7-13H,1-6H3,(H,28,29)(H2,25,26,27,30) |
| InChIKey | ZQYIIEGCYLNBJN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|