C19H29FN2O4 — CID 144982493
(E)-N-[(5-tert-butyl-2-fluoro-4-methoxy-3-methylphenyl)carbamoyl]-3-methoxyprop-2-enamide;ethane (PubChem CID 144982493) has the molecular formula C19H29FN2O4 and a molecular weight of 368.45 g/mol. Its IUPAC name is (E)-N-[(5-tert-butyl-2-fluoro-4-methoxy-3-methylphenyl)carbamoyl]-3-methoxyprop-2-enamide;ethane.
| Compound Name | (E)-N-[(5-tert-butyl-2-fluoro-4-methoxy-3-methylphenyl)carbamoyl]-3-methoxyprop-2-enamide;ethane |
|---|---|
| PubChem CID | 144982493 |
| Molecular Formula | C19H29FN2O4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (E)-N-[(5-tert-butyl-2-fluoro-4-methoxy-3-methylphenyl)carbamoyl]-3-methoxyprop-2-enamide;ethane |
| SMILES | CC.CO/C=C/C(=O)NC(=O)Nc1cc(C(C)(C)C)c(OC)c(C)c1F |
| InChI | InChI=1S/C17H23FN2O4.C2H6/c1-10-14(18)12(9-11(15(10)24-6)17(2,3)4)19-16(22)20-13(21)7-8-23-5;1-2/h7-9H,1-6H3,(H2,19,20,21,22);1-2H3/b8-7+; |
| InChIKey | UGJBDUNOZMJTFS-USRGLUTNSA-N |
| XLogP | 4.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|