C15H17BrClFN2O3 — CID 118612688
(E)-N-[(3-bromo-5-tert-butyl-4-chloro-2-fluorophenyl)carbamoyl]-3-methoxyprop-2-enamide (PubChem CID 118612688) has the molecular formula C15H17BrClFN2O3 and a molecular weight of 407.67 g/mol. Its IUPAC name is (E)-N-[(3-bromo-5-tert-butyl-4-chloro-2-fluorophenyl)carbamoyl]-3-methoxyprop-2-enamide.
| Compound Name | (E)-N-[(3-bromo-5-tert-butyl-4-chloro-2-fluorophenyl)carbamoyl]-3-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 118612688 |
| Molecular Formula | C15H17BrClFN2O3 |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | (E)-N-[(3-bromo-5-tert-butyl-4-chloro-2-fluorophenyl)carbamoyl]-3-methoxyprop-2-enamide |
| SMILES | CO/C=C/C(=O)NC(=O)Nc1cc(C(C)(C)C)c(Cl)c(Br)c1F |
| InChI | InChI=1S/C15H17BrClFN2O3/c1-15(2,3)8-7-9(13(18)11(16)12(8)17)19-14(22)20-10(21)5-6-23-4/h5-7H,1-4H3,(H2,19,20,21,22)/b6-5+ |
| InChIKey | NUHBNEIDINFTDU-AATRIKPKSA-N |
| XLogP | 4.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|