C17H26BrFN2O — CID 169074986
1-(4-bromo-5-tert-butyl-2-fluorophenyl)-3-(3,3-dimethylbutyl)urea (PubChem CID 169074986) has the molecular formula C17H26BrFN2O and a molecular weight of 373.31 g/mol. Its IUPAC name is 1-(4-bromo-5-tert-butyl-2-fluorophenyl)-3-(3,3-dimethylbutyl)urea.
| Compound Name | 1-(4-bromo-5-tert-butyl-2-fluorophenyl)-3-(3,3-dimethylbutyl)urea |
|---|---|
| PubChem CID | 169074986 |
| Molecular Formula | C17H26BrFN2O |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-(4-bromo-5-tert-butyl-2-fluorophenyl)-3-(3,3-dimethylbutyl)urea |
| SMILES | CC(C)(C)CCNC(=O)Nc1cc(C(C)(C)C)c(Br)cc1F |
| InChI | InChI=1S/C17H26BrFN2O/c1-16(2,3)7-8-20-15(22)21-14-9-11(17(4,5)6)12(18)10-13(14)19/h9-10H,7-8H2,1-6H3,(H2,20,21,22) |
| InChIKey | UCMWIAZVJFBYNB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |