C26H29N3O3 — CID 67067270
(E)-3-[2-[hydroxy(phenyl)methyl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one (PubChem CID 67067270) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (E)-3-[2-[hydroxy(phenyl)methyl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-[hydroxy(phenyl)methyl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 67067270 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (E)-3-[2-[hydroxy(phenyl)methyl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/N2CCCCC2C(O)c2ccccc2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H29N3O3/c1-19-17-29(18-27-19)22-12-11-21(16-25(22)32-2)24(30)13-15-28-14-7-6-10-23(28)26(31)20-8-4-3-5-9-20/h3-5,8-9,11-13,15-18,23,26,31H,6-7,10,14H2,1-2H3/b15-13+ |
| InChIKey | UTBXPBAHFQOEBG-FYWRMAATSA-N |
| XLogP | 4.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|