C35H46N4O3Si — CID 77211930
3-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-2-yl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one (PubChem CID 77211930) has the molecular formula C35H46N4O3Si and a molecular weight of 598.86 g/mol. Its IUPAC name is 3-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-2-yl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 3-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-2-yl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 77211930 |
| Molecular Formula | C35H46N4O3Si |
| Molecular Weight | 598.86 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 3-[4-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]indol-2-yl]piperidin-1-yl]-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(C(=O)C=CN2CCC(c3cc4ccccc4n3CCO[Si](C)(C)C(C)(C)C)CC2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C35H46N4O3Si/c1-26-24-38(25-36-26)31-13-12-29(23-34(31)41-5)33(40)16-19-37-17-14-27(15-18-37)32-22-28-10-8-9-11-30(28)39(32)20-21-42-43(6,7)35(2,3)4/h8-13,16,19,22-25,27H,14-15,17-18,20-21H2,1-7H3 |
| InChIKey | YQKPXMXVKGNGRS-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 61.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.86 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|