C16H13NO3 — CID 67067766
1-(2,3-dimethoxy-4-pyridinyl)-3-phenylprop-2-yn-1-one (PubChem CID 67067766) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-(2,3-dimethoxy-4-pyridinyl)-3-phenylprop-2-yn-1-one.
| Compound Name | 1-(2,3-dimethoxy-4-pyridinyl)-3-phenylprop-2-yn-1-one |
|---|---|
| PubChem CID | 67067766 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-(2,3-dimethoxy-4-pyridinyl)-3-phenylprop-2-yn-1-one |
| SMILES | COc1nccc(C(=O)C#Cc2ccccc2)c1OC |
| InChI | InChI=1S/C16H13NO3/c1-19-15-13(10-11-17-16(15)20-2)14(18)9-8-12-6-4-3-5-7-12/h3-7,10-11H,1-2H3 |
| InChIKey | BBRZINKNSLSKAG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|