C17H12N2O5S — CID 67067779
7-methoxy-6-(3-phenylprop-2-ynoyl)indazole-1-sulfonic acid (PubChem CID 67067779) has the molecular formula C17H12N2O5S and a molecular weight of 356.36 g/mol. Its IUPAC name is 7-methoxy-6-(3-phenylprop-2-ynoyl)indazole-1-sulfonic acid.
| Compound Name | 7-methoxy-6-(3-phenylprop-2-ynoyl)indazole-1-sulfonic acid |
|---|---|
| PubChem CID | 67067779 |
| Molecular Formula | C17H12N2O5S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 7-methoxy-6-(3-phenylprop-2-ynoyl)indazole-1-sulfonic acid |
| SMILES | COc1c(C(=O)C#Cc2ccccc2)ccc2cnn(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C17H12N2O5S/c1-24-17-14(15(20)10-7-12-5-3-2-4-6-12)9-8-13-11-18-19(16(13)17)25(21,22)23/h2-6,8-9,11H,1H3,(H,21,22,23) |
| InChIKey | CUHAFECWSSDYSX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|