About 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate
2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate (PubChem CID 67073792) has the molecular formula C23H24BCl2NO3
and a molecular weight of 444.17 g/mol. Its IUPAC name is 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate.
Molecular Properties
| Compound Name | 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate |
| PubChem CID | 67073792 |
| Molecular Formula | C23H24BCl2NO3 |
| Molecular Weight | 444.17 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate |
| SMILES | Cc1ccc(OB(OCCNCc2ccccc2)Oc2ccc(C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C23H24BCl2NO3/c1-17-8-10-20(14-22(17)25)29-24(30-21-11-9-18(2)23(26)15-21)28-13-12-27-16-19-6-4-3-5-7-19/h3-11,14-15,27H,12-13,16H2,1-2H3 |
| InChIKey | CZXWQIIUIYHASG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.17 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate?
The IUPAC name of 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate (CID 67073792) is 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate.
What is the SMILES notation for 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate?
The canonical SMILES for 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate is Cc1ccc(OB(OCCNCc2ccccc2)Oc2ccc(C)c(Cl)c2)cc1Cl.
What is the InChIKey of 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate?
The InChIKey is CZXWQIIUIYHASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24BCl2NO3/c1-17-8-10-20(14-22(17)25)29-24(30-21-11-9-18(2)23(26)15-21)28-13-12-27-16-19-6-4-3-5-7-19/h3-11,14-15,27H,12-13,16H2,1-2H3.
What are the key properties of 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate?
2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate has a molecular weight of 444.17 g/mol, XLogP of 5.86, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)ethyl bis(3-chloro-4-methylphenyl) borate is sourced from PubChem (CID 67073792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).