C25H31N3O — CID 67076033
N-[4-(1-aminopropyl)-4-(4-methoxyphenyl)cyclohexyl]isoquinolin-6-amine (PubChem CID 67076033) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is N-[4-(1-aminopropyl)-4-(4-methoxyphenyl)cyclohexyl]isoquinolin-6-amine.
| Compound Name | N-[4-(1-aminopropyl)-4-(4-methoxyphenyl)cyclohexyl]isoquinolin-6-amine |
|---|---|
| PubChem CID | 67076033 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | N-[4-(1-aminopropyl)-4-(4-methoxyphenyl)cyclohexyl]isoquinolin-6-amine |
| SMILES | CCC(N)C1(c2ccc(OC)cc2)CCC(Nc2ccc3cnccc3c2)CC1 |
| InChI | InChI=1S/C25H31N3O/c1-3-24(26)25(20-5-8-23(29-2)9-6-20)13-10-21(11-14-25)28-22-7-4-19-17-27-15-12-18(19)16-22/h4-9,12,15-17,21,24,28H,3,10-11,13-14,26H2,1-2H3 |
| InChIKey | RBMLFOQLFNJMOC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |