About ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine
ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine (PubChem CID 143705380) has the molecular formula C19H29N3O
and a molecular weight of 315.46 g/mol. Its IUPAC name is ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine.
Molecular Properties
| Compound Name | ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine |
| PubChem CID | 143705380 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine |
| SMILES | CC.CC(C)C=O.c1cc2cc(N[C@@H]3CCNC3)ccc2cn1 |
| InChI | InChI=1S/C13H15N3.C4H8O.C2H6/c1-2-12(16-13-4-6-15-9-13)7-10-3-5-14-8-11(1)10;1-4(2)3-5;1-2/h1-3,5,7-8,13,15-16H,4,6,9H2;3-4H,1-2H3;1-2H3/t13-;;/m1../s1 |
| InChIKey | MKROCHRADQTEHF-FFXKMJQXSA-N |
| XLogP | 3.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine?
The IUPAC name of ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine (CID 143705380) is ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine.
What is the SMILES notation for ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine?
The canonical SMILES for ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine is CC.CC(C)C=O.c1cc2cc(N[C@@H]3CCNC3)ccc2cn1.
What is the InChIKey of ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine?
The InChIKey is MKROCHRADQTEHF-FFXKMJQXSA-N. The full InChI is InChI=1S/C13H15N3.C4H8O.C2H6/c1-2-12(16-13-4-6-15-9-13)7-10-3-5-14-8-11(1)10;1-4(2)3-5;1-2/h1-3,5,7-8,13,15-16H,4,6,9H2;3-4H,1-2H3;1-2H3/t13-;;/m1../s1.
What are the key properties of ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine?
ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine has a molecular weight of 315.46 g/mol, XLogP of 3.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropanal;N-[(3R)-pyrrolidin-3-yl]isoquinolin-6-amine is sourced from PubChem (CID 143705380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).