C18H24N4O2 — CID 25108977
(2S,4R)-4-(isoquinolin-6-ylamino)-N-(3-methoxypropyl)pyrrolidine-2-carboxamide (PubChem CID 25108977) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2S,4R)-4-(isoquinolin-6-ylamino)-N-(3-methoxypropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(isoquinolin-6-ylamino)-N-(3-methoxypropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25108977 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (2S,4R)-4-(isoquinolin-6-ylamino)-N-(3-methoxypropyl)pyrrolidine-2-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1C[C@@H](Nc2ccc3cnccc3c2)CN1 |
| InChI | InChI=1S/C18H24N4O2/c1-24-8-2-6-20-18(23)17-10-16(12-21-17)22-15-4-3-14-11-19-7-5-13(14)9-15/h3-5,7,9,11,16-17,21-22H,2,6,8,10,12H2,1H3,(H,20,23)/t16-,17+/m1/s1 |
| InChIKey | GONXROBXNNDVAK-SJORKVTESA-N |
| XLogP | 1.53 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|