C17H21N3O3 — CID 143705555
(2S,4R)-N-(3-hydroxypropyl)-4-isoquinolin-6-yloxypyrrolidine-2-carboxamide (PubChem CID 143705555) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2S,4R)-N-(3-hydroxypropyl)-4-isoquinolin-6-yloxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-(3-hydroxypropyl)-4-isoquinolin-6-yloxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143705555 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2S,4R)-N-(3-hydroxypropyl)-4-isoquinolin-6-yloxypyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCO)[C@@H]1C[C@@H](Oc2ccc3cnccc3c2)CN1 |
| InChI | InChI=1S/C17H21N3O3/c21-7-1-5-19-17(22)16-9-15(11-20-16)23-14-3-2-13-10-18-6-4-12(13)8-14/h2-4,6,8,10,15-16,20-21H,1,5,7,9,11H2,(H,19,22)/t15-,16+/m1/s1 |
| InChIKey | FLAHDECOKRPSDQ-CVEARBPZSA-N |
| XLogP | 0.84 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|