C22H27N5O2 — CID 22084742
4-(3-carbamimidoylphenoxy)-N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]pyrrolidine-2-carboxamide (PubChem CID 22084742) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-(3-carbamimidoylphenoxy)-N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 4-(3-carbamimidoylphenoxy)-N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22084742 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 4-(3-carbamimidoylphenoxy)-N-[2-(2,3-dihydro-1H-indol-3-yl)ethyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(OC2CNC(C(=O)NCCC3CNc4ccccc43)C2)c1 |
| InChI | InChI=1S/C22H27N5O2/c23-21(24)14-4-3-5-16(10-14)29-17-11-20(27-13-17)22(28)25-9-8-15-12-26-19-7-2-1-6-18(15)19/h1-7,10,15,17,20,26-27H,8-9,11-13H2,(H3,23,24)(H,25,28) |
| InChIKey | DONSJWPIINOGFS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|