C14H19N3O3 — CID 22084737
4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylic acid (PubChem CID 22084737) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylic acid.
| Compound Name | 4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22084737 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylic acid |
| SMILES | [H]/N=C(\N)c1cccc(OC2CC(C(=O)O)N(CC)C2)c1 |
| InChI | InChI=1S/C14H19N3O3/c1-2-17-8-11(7-12(17)14(18)19)20-10-5-3-4-9(6-10)13(15)16/h3-6,11-12H,2,7-8H2,1H3,(H3,15,16)(H,18,19) |
| InChIKey | RUTUQBAQDKIFEQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|