C27H29N7O4 — CID 10301391
(2S,4R)-4-(3-carbamimidoylphenoxy)-N-[(4-carbamimidoylphenyl)methyl]-1-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 10301391) has the molecular formula C27H29N7O4 and a molecular weight of 515.57 g/mol. Its IUPAC name is (2S,4R)-4-(3-carbamimidoylphenoxy)-N-[(4-carbamimidoylphenyl)methyl]-1-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(3-carbamimidoylphenoxy)-N-[(4-carbamimidoylphenyl)methyl]-1-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10301391 |
| Molecular Formula | C27H29N7O4 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (2S,4R)-4-(3-carbamimidoylphenoxy)-N-[(4-carbamimidoylphenyl)methyl]-1-[(4-nitrophenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2C[C@@H](Oc3cccc(/C(N)=N/[H])c3)CN2Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H29N7O4/c28-25(29)19-8-4-17(5-9-19)14-32-27(35)24-13-23(38-22-3-1-2-20(12-22)26(30)31)16-33(24)15-18-6-10-21(11-7-18)34(36)37/h1-12,23-24H,13-16H2,(H3,28,29)(H3,30,31)(H,32,35)/t23-,24+/m1/s1 |
| InChIKey | NGGIZDPSBLOERB-RPWUZVMVSA-N |
| XLogP | 2.50 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|