C17H23N3O3 — CID 59897327
prop-2-enyl (2S,4R)-4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylate (PubChem CID 59897327) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is prop-2-enyl (2S,4R)-4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylate.
| Compound Name | prop-2-enyl (2S,4R)-4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 59897327 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | prop-2-enyl (2S,4R)-4-(3-carbamimidoylphenoxy)-1-ethylpyrrolidine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1cccc(O[C@@H]2C[C@@H](C(=O)OCC=C)N(CC)C2)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-3-8-22-17(21)15-10-14(11-20(15)4-2)23-13-7-5-6-12(9-13)16(18)19/h3,5-7,9,14-15H,1,4,8,10-11H2,2H3,(H3,18,19)/t14-,15+/m1/s1 |
| InChIKey | FXHQMXJGLNIZLP-CABCVRRESA-N |
| XLogP | 1.54 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|