C20H23ClN4O2 — CID 59897334
(2S,4R)-4-(3-carbamimidoylphenoxy)-N-(4-chlorophenyl)-1-ethylpyrrolidine-2-carboxamide (PubChem CID 59897334) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is (2S,4R)-4-(3-carbamimidoylphenoxy)-N-(4-chlorophenyl)-1-ethylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(3-carbamimidoylphenoxy)-N-(4-chlorophenyl)-1-ethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59897334 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2S,4R)-4-(3-carbamimidoylphenoxy)-N-(4-chlorophenyl)-1-ethylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(O[C@@H]2C[C@@H](C(=O)Nc3ccc(Cl)cc3)N(CC)C2)c1 |
| InChI | InChI=1S/C20H23ClN4O2/c1-2-25-12-17(27-16-5-3-4-13(10-16)19(22)23)11-18(25)20(26)24-15-8-6-14(21)7-9-15/h3-10,17-18H,2,11-12H2,1H3,(H3,22,23)(H,24,26)/t17-,18+/m1/s1 |
| InChIKey | RFSAOXLNCUCZKF-MSOLQXFVSA-N |
| XLogP | 3.10 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|