About N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline
N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline (PubChem CID 143705584) has the molecular formula C23H26ClN3O
and a molecular weight of 395.93 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline.
Molecular Properties
| Compound Name | N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline |
| PubChem CID | 143705584 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline |
| SMILES | CC1CNC(C(=O)NCc2ccccc2Cl)C1.Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C13H17ClN2O.C10H9N/c1-9-6-12(15-7-9)13(17)16-8-10-4-2-3-5-11(10)14;1-8-2-3-10-7-11-5-4-9(10)6-8/h2-5,9,12,15H,6-8H2,1H3,(H,16,17);2-7H,1H3 |
| InChIKey | INEZXZNCAFIKHU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline?
The IUPAC name of N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline (CID 143705584) is N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline.
What is the SMILES notation for N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline?
The canonical SMILES for N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline is CC1CNC(C(=O)NCc2ccccc2Cl)C1.Cc1ccc2cnccc2c1.
What is the InChIKey of N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline?
The InChIKey is INEZXZNCAFIKHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O.C10H9N/c1-9-6-12(15-7-9)13(17)16-8-10-4-2-3-5-11(10)14;1-8-2-3-10-7-11-5-4-9(10)6-8/h2-5,9,12,15H,6-8H2,1H3,(H,16,17);2-7H,1H3.
What are the key properties of N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline?
N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline has a molecular weight of 395.93 g/mol, XLogP of 4.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline is sourced from PubChem (CID 143705584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).