C23H26ClN3O — CID 143705584
N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline (PubChem CID 143705584) has the molecular formula C23H26ClN3O and a molecular weight of 395.93 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline |
|---|---|
| PubChem CID | 143705584 |
| Molecular Formula | C23H26ClN3O |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-methylpyrrolidine-2-carboxamide;6-methylisoquinoline |
| SMILES | CC1CNC(C(=O)NCc2ccccc2Cl)C1.Cc1ccc2cnccc2c1 |
| InChI | InChI=1S/C13H17ClN2O.C10H9N/c1-9-6-12(15-7-9)13(17)16-8-10-4-2-3-5-11(10)14;1-8-2-3-10-7-11-5-4-9(10)6-8/h2-5,9,12,15H,6-8H2,1H3,(H,16,17);2-7H,1H3 |
| InChIKey | INEZXZNCAFIKHU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |