About 2-(3-chloro-4,5-difluorophenyl)aniline
2-(3-chloro-4,5-difluorophenyl)aniline (PubChem CID 67076113) has the molecular formula C12H8ClF2N
and a molecular weight of 239.65 g/mol. Its IUPAC name is 2-(3-chloro-4,5-difluorophenyl)aniline.
Molecular Properties
| Compound Name | 2-(3-chloro-4,5-difluorophenyl)aniline |
| PubChem CID | 67076113 |
| Molecular Formula | C12H8ClF2N |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-(3-chloro-4,5-difluorophenyl)aniline |
| SMILES | Nc1ccccc1-c1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H8ClF2N/c13-9-5-7(6-10(14)12(9)15)8-3-1-2-4-11(8)16/h1-6H,16H2 |
| InChIKey | GGHKUMDZVILSMH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloro-4,5-difluorophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-4,5-difluorophenyl)aniline?
The IUPAC name of 2-(3-chloro-4,5-difluorophenyl)aniline (CID 67076113) is 2-(3-chloro-4,5-difluorophenyl)aniline.
What is the SMILES notation for 2-(3-chloro-4,5-difluorophenyl)aniline?
The canonical SMILES for 2-(3-chloro-4,5-difluorophenyl)aniline is Nc1ccccc1-c1cc(F)c(F)c(Cl)c1.
What is the InChIKey of 2-(3-chloro-4,5-difluorophenyl)aniline?
The InChIKey is GGHKUMDZVILSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClF2N/c13-9-5-7(6-10(14)12(9)15)8-3-1-2-4-11(8)16/h1-6H,16H2.
What are the key properties of 2-(3-chloro-4,5-difluorophenyl)aniline?
2-(3-chloro-4,5-difluorophenyl)aniline has a molecular weight of 239.65 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-4,5-difluorophenyl)aniline is sourced from PubChem (CID 67076113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).