C12H24O2Si — CID 67076217
tert-butyl-dimethyl-(2,3,4,7-tetrahydrooxepin-4-yloxy)silane (PubChem CID 67076217) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,3,4,7-tetrahydrooxepin-4-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,3,4,7-tetrahydrooxepin-4-yloxy)silane |
|---|---|
| PubChem CID | 67076217 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | tert-butyl-dimethyl-(2,3,4,7-tetrahydrooxepin-4-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=CCOCC1 |
| InChI | InChI=1S/C12H24O2Si/c1-12(2,3)15(4,5)14-11-7-6-9-13-10-8-11/h6-7,11H,8-10H2,1-5H3 |
| InChIKey | GTEZLYXPRFURCV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|