C17H24O4 — CID 67076318
4-methoxy-3-[2-(3-methylcyclohexyl)ethoxy]benzoic acid (PubChem CID 67076318) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-methoxy-3-[2-(3-methylcyclohexyl)ethoxy]benzoic acid.
| Compound Name | 4-methoxy-3-[2-(3-methylcyclohexyl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 67076318 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4-methoxy-3-[2-(3-methylcyclohexyl)ethoxy]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OCCC1CCCC(C)C1 |
| InChI | InChI=1S/C17H24O4/c1-12-4-3-5-13(10-12)8-9-21-16-11-14(17(18)19)6-7-15(16)20-2/h6-7,11-13H,3-5,8-10H2,1-2H3,(H,18,19) |
| InChIKey | MRFJSHQVPSFDQH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |